About 6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one
6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one (PubChem CID 24827681) has the molecular formula C21H10F12NOP
and a molecular weight of 551.27 g/mol. Its IUPAC name is 6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one |
| PubChem CID | 24827681 |
| Molecular Formula | C21H10F12NOP |
| Molecular Weight | 551.27 g/mol |
| Exact Mass | 551.03 |
| IUPAC Name | 6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one |
| SMILES | O=c1cccc(P(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[nH]1 |
| InChI | InChI=1S/C21H10F12NOP/c22-18(23,24)10-4-11(19(25,26)27)7-14(6-10)36(17-3-1-2-16(35)34-17)15-8-12(20(28,29)30)5-13(9-15)21(31,32)33/h1-9H,(H,34,35) |
| InChIKey | QOUPEMSAKZSYMG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 551.27 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one?
The IUPAC name of 6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one (CID 24827681) is 6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one.
What is the SMILES notation for 6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one?
The canonical SMILES for 6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one is O=c1cccc(P(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[nH]1.
What is the InChIKey of 6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one?
The InChIKey is QOUPEMSAKZSYMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H10F12NOP/c22-18(23,24)10-4-11(19(25,26)27)7-14(6-10)36(17-3-1-2-16(35)34-17)15-8-12(20(28,29)30)5-13(9-15)21(31,32)33/h1-9H,(H,34,35).
What are the key properties of 6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one?
6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one has a molecular weight of 551.27 g/mol, XLogP of 6.21, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl-1H-pyridin-2-one is sourced from PubChem (CID 24827681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).