C25H38O3S — CID 24827974
(4S,5S)-2,2-dimethyl-5-[(E)-1-(4-methylphenyl)sulfanyldodec-3-enyl]-1,3-dioxolane-4-carbaldehyde (PubChem CID 24827974) has the molecular formula C25H38O3S and a molecular weight of 418.64 g/mol. Its IUPAC name is (4S,5S)-2,2-dimethyl-5-[(E)-1-(4-methylphenyl)sulfanyldodec-3-enyl]-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4S,5S)-2,2-dimethyl-5-[(E)-1-(4-methylphenyl)sulfanyldodec-3-enyl]-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 24827974 |
| Molecular Formula | C25H38O3S |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | (4S,5S)-2,2-dimethyl-5-[(E)-1-(4-methylphenyl)sulfanyldodec-3-enyl]-1,3-dioxolane-4-carbaldehyde |
| SMILES | CCCCCCCC/C=C/CC(Sc1ccc(C)cc1)[C@H]1OC(C)(C)O[C@@H]1C=O |
| InChI | InChI=1S/C25H38O3S/c1-5-6-7-8-9-10-11-12-13-14-23(29-21-17-15-20(2)16-18-21)24-22(19-26)27-25(3,4)28-24/h12-13,15-19,22-24H,5-11,14H2,1-4H3/b13-12+/t22-,23?,24+/m1/s1 |
| InChIKey | HSQSFGWPAIJFMF-BPPDIQLLSA-N |
| XLogP | 6.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|