About N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide
N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide (PubChem CID 24828113) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide |
| PubChem CID | 24828113 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide |
| SMILES | CON(C)C(=O)c1coc(C)n1 |
| InChI | InChI=1S/C7H10N2O3/c1-5-8-6(4-12-5)7(10)9(2)11-3/h4H,1-3H3 |
| InChIKey | KSZXOXXGUAYWRJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide?
The IUPAC name of N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide (CID 24828113) is N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide is CON(C)C(=O)c1coc(C)n1.
What is the InChIKey of N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide?
The InChIKey is KSZXOXXGUAYWRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-5-8-6(4-12-5)7(10)9(2)11-3/h4H,1-3H3.
What are the key properties of N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide?
N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide has a molecular weight of 170.17 g/mol, XLogP of 0.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N,2-dimethyl-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 24828113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).