C29H42O3SSi — CID 24828227
S-ethyl (E,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxydec-2-enethioate (PubChem CID 24828227) has the molecular formula C29H42O3SSi and a molecular weight of 498.81 g/mol. Its IUPAC name is S-ethyl (E,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxydec-2-enethioate.
| Compound Name | S-ethyl (E,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxydec-2-enethioate |
|---|---|
| PubChem CID | 24828227 |
| Molecular Formula | C29H42O3SSi |
| Molecular Weight | 498.81 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | S-ethyl (E,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxydec-2-enethioate |
| SMILES | CCC[C@@H](C[C@H](C/C=C/C(=O)SCC)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H42O3SSi/c1-7-16-25(23-24(31-6)17-15-22-28(30)33-8-2)32-34(29(3,4)5,26-18-11-9-12-19-26)27-20-13-10-14-21-27/h9-15,18-22,24-25H,7-8,16-17,23H2,1-6H3/b22-15+/t24-,25-/m0/s1 |
| InChIKey | BMWHJLAVSKLFLS-JEDGLQCNSA-N |
| XLogP | 6.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.81 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|