C30H46O3SSi — CID 24828357
S-ethyl (3S,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-3-methyldecanethioate (PubChem CID 24828357) has the molecular formula C30H46O3SSi and a molecular weight of 514.85 g/mol. Its IUPAC name is S-ethyl (3S,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-3-methyldecanethioate.
| Compound Name | S-ethyl (3S,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-3-methyldecanethioate |
|---|---|
| PubChem CID | 24828357 |
| Molecular Formula | C30H46O3SSi |
| Molecular Weight | 514.85 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | S-ethyl (3S,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-3-methyldecanethioate |
| SMILES | CCC[C@@H](C[C@H](C[C@H](C)CC(=O)SCC)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H46O3SSi/c1-8-16-25(23-26(32-7)21-24(3)22-29(31)34-9-2)33-35(30(4,5)6,27-17-12-10-13-18-27)28-19-14-11-15-20-28/h10-15,17-20,24-26H,8-9,16,21-23H2,1-7H3/t24-,25-,26-/m0/s1 |
| InChIKey | UNJQGCCEXBZNBJ-GSDHBNRESA-N |
| XLogP | 6.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.85 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|