C28H42O3Si — CID 24828358
(3S,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-3-methyldecanal (PubChem CID 24828358) has the molecular formula C28H42O3Si and a molecular weight of 454.73 g/mol. Its IUPAC name is (3S,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-3-methyldecanal.
| Compound Name | (3S,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-3-methyldecanal |
|---|---|
| PubChem CID | 24828358 |
| Molecular Formula | C28H42O3Si |
| Molecular Weight | 454.73 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | (3S,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-3-methyldecanal |
| SMILES | CCC[C@@H](C[C@H](C[C@H](C)CC=O)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H42O3Si/c1-7-14-24(22-25(30-6)21-23(2)19-20-29)31-32(28(3,4)5,26-15-10-8-11-16-26)27-17-12-9-13-18-27/h8-13,15-18,20,23-25H,7,14,19,21-22H2,1-6H3/t23-,24+,25+/m1/s1 |
| InChIKey | QTFGBGNLTGXFBM-DSITVLBTSA-N |
| XLogP | 5.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.73 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|