C43H59F3O6Si — CID 24828359
[(2R,4S,6S)-2-[(2S,4S,6S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-6-(2-phenylmethoxyethyl)oxan-4-yl] 2,2,2-trifluoroacetate (PubChem CID 24828359) has the molecular formula C43H59F3O6Si and a molecular weight of 757.02 g/mol. Its IUPAC name is [(2R,4S,6S)-2-[(2S,4S,6S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-6-(2-phenylmethoxyethyl)oxan-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2R,4S,6S)-2-[(2S,4S,6S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-6-(2-phenylmethoxyethyl)oxan-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 24828359 |
| Molecular Formula | C43H59F3O6Si |
| Molecular Weight | 757.02 g/mol |
| Exact Mass | 756.40 |
| IUPAC Name | [(2R,4S,6S)-2-[(2S,4S,6S)-6-[tert-butyl(diphenyl)silyl]oxy-4-methoxy-2-methylnonyl]-6-(2-phenylmethoxyethyl)oxan-4-yl] 2,2,2-trifluoroacetate |
| SMILES | CCC[C@@H](C[C@H](C[C@H](C)C[C@@H]1C[C@H](OC(=O)C(F)(F)F)C[C@H](CCOCc2ccccc2)O1)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C43H59F3O6Si/c1-7-17-35(52-53(42(3,4)5,39-20-13-9-14-21-39)40-22-15-10-16-23-40)29-36(48-6)26-32(2)27-37-30-38(51-41(47)43(44,45)46)28-34(50-37)24-25-49-31-33-18-11-8-12-19-33/h8-16,18-23,32,34-38H,7,17,24-31H2,1-6H3/t32-,34-,35-,36-,37+,38+/m0/s1 |
| InChIKey | KBIMENLJAGRSJU-DPXDBDOVSA-N |
| XLogP | 9.18 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.02 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|