C13H23NO4 — CID 24828451
7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-ylmethanamine (PubChem CID 24828451) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is 7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-ylmethanamine.
| Compound Name | 7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-ylmethanamine |
|---|---|
| PubChem CID | 24828451 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 7,8,15,16-tetraoxadispiro[5.2.59.26]hexadecan-12-ylmethanamine |
| SMILES | NCC1CCC2(CC1)OOC1(CCCCC1)OO2 |
| InChI | InChI=1S/C13H23NO4/c14-10-11-4-8-13(9-5-11)17-15-12(16-18-13)6-2-1-3-7-12/h11H,1-10,14H2 |
| InChIKey | TUIHEAJJIRBSIC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|