C18H17NO2 — CID 24829043
3-[(2R,3aS)-3-methylidene-4-oxo-2-phenyl-5,6-dihydro-1-benzofuran-3a-yl]propanenitrile (PubChem CID 24829043) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[(2R,3aS)-3-methylidene-4-oxo-2-phenyl-5,6-dihydro-1-benzofuran-3a-yl]propanenitrile.
| Compound Name | 3-[(2R,3aS)-3-methylidene-4-oxo-2-phenyl-5,6-dihydro-1-benzofuran-3a-yl]propanenitrile |
|---|---|
| PubChem CID | 24829043 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-[(2R,3aS)-3-methylidene-4-oxo-2-phenyl-5,6-dihydro-1-benzofuran-3a-yl]propanenitrile |
| SMILES | C=C1[C@@H](c2ccccc2)OC2=CCCC(=O)[C@@]12CCC#N |
| InChI | InChI=1S/C18H17NO2/c1-13-17(14-7-3-2-4-8-14)21-16-10-5-9-15(20)18(13,16)11-6-12-19/h2-4,7-8,10,17H,1,5-6,9,11H2/t17-,18+/m0/s1 |
| InChIKey | ZCYCDMSZDDYVJW-ZWKOTPCHSA-N |
| XLogP | 3.85 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|