About 2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one
2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one (PubChem CID 24829159) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one |
| PubChem CID | 24829159 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one |
| SMILES | COC1=CC(=O)OC(C2CCCCC2)C1 |
| InChI | InChI=1S/C12H18O3/c1-14-10-7-11(15-12(13)8-10)9-5-3-2-4-6-9/h8-9,11H,2-7H2,1H3 |
| InChIKey | QUDVCBZSSLLDPX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one?
The IUPAC name of 2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one (CID 24829159) is 2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one.
What is the SMILES notation for 2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one?
The canonical SMILES for 2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one is COC1=CC(=O)OC(C2CCCCC2)C1.
What is the InChIKey of 2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one?
The InChIKey is QUDVCBZSSLLDPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-14-10-7-11(15-12(13)8-10)9-5-3-2-4-6-9/h8-9,11H,2-7H2,1H3.
What are the key properties of 2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one?
2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one has a molecular weight of 210.27 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-4-methoxy-2,3-dihydropyran-6-one is sourced from PubChem (CID 24829159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).