About CID 24829180
CID 24829180 (PubChem CID 24829180) has the molecular formula C13H28O2Si3
and a molecular weight of 300.62 g/mol.
Molecular Properties
| Compound Name | CID 24829180 |
| PubChem CID | 24829180 |
| Molecular Formula | C13H28O2Si3 |
| Molecular Weight | 300.62 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | — |
| SMILES | C=CCOCC1CC([Si](C)C)([Si](C)C)[Si](C)(C)O1 |
| InChI | InChI=1S/C13H28O2Si3/c1-8-9-14-11-12-10-13(16(2)3,17(4)5)18(6,7)15-12/h8,12H,1,9-11H2,2-7H3 |
| InChIKey | YKTKYGZIHOFBPT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.62 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 24829180 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24829180?
The IUPAC name of CID 24829180 (CID 24829180) is not available.
What is the SMILES notation for CID 24829180?
The canonical SMILES for CID 24829180 is C=CCOCC1CC([Si](C)C)([Si](C)C)[Si](C)(C)O1.
What is the InChIKey of CID 24829180?
The InChIKey is YKTKYGZIHOFBPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O2Si3/c1-8-9-14-11-12-10-13(16(2)3,17(4)5)18(6,7)15-12/h8,12H,1,9-11H2,2-7H3.
What are the key properties of CID 24829180?
CID 24829180 has a molecular weight of 300.62 g/mol, XLogP of 3.51, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24829180 is sourced from PubChem (CID 24829180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).