C27H34N8O9 — CID 24829229
2-[[1-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-3-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]propan-2-yl]amino]acetic acid (PubChem CID 24829229) has the molecular formula C27H34N8O9 and a molecular weight of 614.62 g/mol. Its IUPAC name is 2-[[1-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-3-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]propan-2-yl]amino]acetic acid.
| Compound Name | 2-[[1-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-3-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]propan-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 24829229 |
| Molecular Formula | C27H34N8O9 |
| Molecular Weight | 614.62 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | 2-[[1-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-3-[4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]propan-2-yl]amino]acetic acid |
| SMILES | O=C(O)CNC(Cc1ccc(Nc2ccc([N+](=O)[O-])c3nonc23)cc1)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C27H34N8O9/c36-23(37)14-28-20(15-32-7-9-33(16-24(38)39)11-12-34(10-8-32)17-25(40)41)13-18-1-3-19(4-2-18)29-21-5-6-22(35(42)43)27-26(21)30-44-31-27/h1-6,20,28-29H,7-17H2,(H,36,37)(H,38,39)(H,40,41) |
| InChIKey | GGDXBVUWIMSMKH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 227.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.62 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|