C17H17FN2O5 — CID 24829238
tert-butyl 2-(5-fluoro-2,2',5'-trioxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)acetate (PubChem CID 24829238) has the molecular formula C17H17FN2O5 and a molecular weight of 348.33 g/mol. Its IUPAC name is tert-butyl 2-(5-fluoro-2,2',5'-trioxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)acetate.
| Compound Name | tert-butyl 2-(5-fluoro-2,2',5'-trioxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)acetate |
|---|---|
| PubChem CID | 24829238 |
| Molecular Formula | C17H17FN2O5 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | tert-butyl 2-(5-fluoro-2,2',5'-trioxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)CC2(C(=O)Nc3ccc(F)cc32)C1=O |
| InChI | InChI=1S/C17H17FN2O5/c1-16(2,3)25-13(22)8-20-12(21)7-17(15(20)24)10-6-9(18)4-5-11(10)19-14(17)23/h4-6H,7-8H2,1-3H3,(H,19,23) |
| InChIKey | IEQFYDBBKJVDAG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|