C18H20N4O2S — CID 24829296
N,4-bis(4-ethoxyphenyl)-5-imino-1,2,4-thiadiazol-3-amine (PubChem CID 24829296) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is N,4-bis(4-ethoxyphenyl)-5-imino-1,2,4-thiadiazol-3-amine.
| Compound Name | N,4-bis(4-ethoxyphenyl)-5-imino-1,2,4-thiadiazol-3-amine |
|---|---|
| PubChem CID | 24829296 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N,4-bis(4-ethoxyphenyl)-5-imino-1,2,4-thiadiazol-3-amine |
| SMILES | [H]/N=c1\snc(Nc2ccc(OCC)cc2)n1-c1ccc(OCC)cc1 |
| InChI | InChI=1S/C18H20N4O2S/c1-3-23-15-9-5-13(6-10-15)20-18-21-25-17(19)22(18)14-7-11-16(12-8-14)24-4-2/h5-12,19H,3-4H2,1-2H3,(H,20,21)/b19-17- |
| InChIKey | WOISKAZMSXCHRK-ZPHPHTNESA-N |
| XLogP | 3.95 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|