C18H8Cl3N5S — CID 24829297
6-quinolin-5-yl-3-(2,3,5-trichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 24829297) has the molecular formula C18H8Cl3N5S and a molecular weight of 432.72 g/mol. Its IUPAC name is 6-quinolin-5-yl-3-(2,3,5-trichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-quinolin-5-yl-3-(2,3,5-trichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 24829297 |
| Molecular Formula | C18H8Cl3N5S |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | 6-quinolin-5-yl-3-(2,3,5-trichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Clc1cc(Cl)c(Cl)c(-c2nnc3sc(-c4cccc5ncccc45)nn23)c1 |
| InChI | InChI=1S/C18H8Cl3N5S/c19-9-7-12(15(21)13(20)8-9)16-23-24-18-26(16)25-17(27-18)11-3-1-5-14-10(11)4-2-6-22-14/h1-8H |
| InChIKey | QYYNPUZEUKYEBE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|