C23H21N9OS — CID 2482938
1-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methylsulfanyl]-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 2482938) has the molecular formula C23H21N9OS and a molecular weight of 471.55 g/mol. Its IUPAC name is 1-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methylsulfanyl]-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methylsulfanyl]-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 2482938 |
| Molecular Formula | C23H21N9OS |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 1-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methylsulfanyl]-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | C=CCn1c(=O)c2ccccc2n2c(SCc3nc(N)nc(Nc4ccccc4C)n3)nnc12 |
| InChI | InChI=1S/C23H21N9OS/c1-3-12-31-19(33)15-9-5-7-11-17(15)32-22(31)29-30-23(32)34-13-18-26-20(24)28-21(27-18)25-16-10-6-4-8-14(16)2/h3-11H,1,12-13H2,2H3,(H3,24,25,26,27,28) |
| InChIKey | PCVKZGCXKPOIJV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|