About 2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid
2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid (PubChem CID 24830401) has the molecular formula C19H31N3O6
and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid |
| PubChem CID | 24830401 |
| Molecular Formula | C19H31N3O6 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid |
| SMILES | CCCCCCn1c(O)c(C(=O)NCC(=O)O)c(=O)n(CCCCCC)c1=O |
| InChI | InChI=1S/C19H31N3O6/c1-3-5-7-9-11-21-17(26)15(16(25)20-13-14(23)24)18(27)22(19(21)28)12-10-8-6-4-2/h26H,3-13H2,1-2H3,(H,20,25)(H,23,24) |
| InChIKey | ILVPGGSCAJCGQC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 130.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid?
The IUPAC name of 2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid (CID 24830401) is 2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid.
What is the SMILES notation for 2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid?
The canonical SMILES for 2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid is CCCCCCn1c(O)c(C(=O)NCC(=O)O)c(=O)n(CCCCCC)c1=O.
What is the InChIKey of 2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid?
The InChIKey is ILVPGGSCAJCGQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N3O6/c1-3-5-7-9-11-21-17(26)15(16(25)20-13-14(23)24)18(27)22(19(21)28)12-10-8-6-4-2/h26H,3-13H2,1-2H3,(H,20,25)(H,23,24).
What are the key properties of 2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid?
2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid has a molecular weight of 397.47 g/mol, XLogP of 1.69, 13 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-dihexyl-4-hydroxy-2,6-dioxopyrimidine-5-carbonyl)amino]acetic acid is sourced from PubChem (CID 24830401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).