C20H15F2N5O — CID 24831094
6-(2,4-difluorophenyl)-3-[1-(4-methoxyphenyl)cyclopropyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazine (PubChem CID 24831094) has the molecular formula C20H15F2N5O and a molecular weight of 379.37 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)-3-[1-(4-methoxyphenyl)cyclopropyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazine.
| Compound Name | 6-(2,4-difluorophenyl)-3-[1-(4-methoxyphenyl)cyclopropyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazine |
|---|---|
| PubChem CID | 24831094 |
| Molecular Formula | C20H15F2N5O |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 6-(2,4-difluorophenyl)-3-[1-(4-methoxyphenyl)cyclopropyl]-[1,2,4]triazolo[4,3-b][1,2,4]triazine |
| SMILES | COc1ccc(C2(c3nnc4ncc(-c5ccc(F)cc5F)nn34)CC2)cc1 |
| InChI | InChI=1S/C20H15F2N5O/c1-28-14-5-2-12(3-6-14)20(8-9-20)18-24-25-19-23-11-17(26-27(18)19)15-7-4-13(21)10-16(15)22/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | YENBWGPQDWUPGQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |