C23H17Cl2F6N3O — CID 24831483
N-[1-[5,7-bis(trifluoromethyl)quinolin-4-yl]piperidin-4-yl]-2,3-dichlorobenzamide (PubChem CID 24831483) has the molecular formula C23H17Cl2F6N3O and a molecular weight of 536.30 g/mol. Its IUPAC name is N-[1-[5,7-bis(trifluoromethyl)quinolin-4-yl]piperidin-4-yl]-2,3-dichlorobenzamide.
| Compound Name | N-[1-[5,7-bis(trifluoromethyl)quinolin-4-yl]piperidin-4-yl]-2,3-dichlorobenzamide |
|---|---|
| PubChem CID | 24831483 |
| Molecular Formula | C23H17Cl2F6N3O |
| Molecular Weight | 536.30 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | N-[1-[5,7-bis(trifluoromethyl)quinolin-4-yl]piperidin-4-yl]-2,3-dichlorobenzamide |
| SMILES | O=C(NC1CCN(c2ccnc3cc(C(F)(F)F)cc(C(F)(F)F)c23)CC1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C23H17Cl2F6N3O/c24-16-3-1-2-14(20(16)25)21(35)33-13-5-8-34(9-6-13)18-4-7-32-17-11-12(22(26,27)28)10-15(19(17)18)23(29,30)31/h1-4,7,10-11,13H,5-6,8-9H2,(H,33,35) |
| InChIKey | JEXASOFLSFKHNB-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.30 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |