C22H22FNO6 — CID 24831799
(3'R,4'S,5'S,6'R,7S)-1-[(4-fluorophenyl)methyl]-6'-(hydroxymethyl)spiro[5H-furo[3,4-f]indole-7,2'-oxane]-3',4',5'-triol (PubChem CID 24831799) has the molecular formula C22H22FNO6 and a molecular weight of 415.42 g/mol. Its IUPAC name is (3'R,4'S,5'S,6'R,7S)-1-[(4-fluorophenyl)methyl]-6'-(hydroxymethyl)spiro[5H-furo[3,4-f]indole-7,2'-oxane]-3',4',5'-triol.
| Compound Name | (3'R,4'S,5'S,6'R,7S)-1-[(4-fluorophenyl)methyl]-6'-(hydroxymethyl)spiro[5H-furo[3,4-f]indole-7,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 24831799 |
| Molecular Formula | C22H22FNO6 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (3'R,4'S,5'S,6'R,7S)-1-[(4-fluorophenyl)methyl]-6'-(hydroxymethyl)spiro[5H-furo[3,4-f]indole-7,2'-oxane]-3',4',5'-triol |
| SMILES | OC[C@H]1O[C@]2(OCc3cc4ccn(Cc5ccc(F)cc5)c4cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H22FNO6/c23-15-3-1-12(2-4-15)9-24-6-5-13-7-14-11-29-22(16(14)8-17(13)24)21(28)20(27)19(26)18(10-25)30-22/h1-8,18-21,25-28H,9-11H2/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | CUBLCVGQXHURNA-BDHVOXNPSA-N |
| XLogP | 0.99 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |