C24H23NO6S — CID 24831970
(3'R,4'S,5'S,6'R,7S)-1-(1-benzothiophen-2-ylmethyl)-6'-(hydroxymethyl)spiro[5H-furo[3,4-f]indole-7,2'-oxane]-3',4',5'-triol (PubChem CID 24831970) has the molecular formula C24H23NO6S and a molecular weight of 453.52 g/mol. Its IUPAC name is (3'R,4'S,5'S,6'R,7S)-1-(1-benzothiophen-2-ylmethyl)-6'-(hydroxymethyl)spiro[5H-furo[3,4-f]indole-7,2'-oxane]-3',4',5'-triol.
| Compound Name | (3'R,4'S,5'S,6'R,7S)-1-(1-benzothiophen-2-ylmethyl)-6'-(hydroxymethyl)spiro[5H-furo[3,4-f]indole-7,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 24831970 |
| Molecular Formula | C24H23NO6S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | (3'R,4'S,5'S,6'R,7S)-1-(1-benzothiophen-2-ylmethyl)-6'-(hydroxymethyl)spiro[5H-furo[3,4-f]indole-7,2'-oxane]-3',4',5'-triol |
| SMILES | OC[C@H]1O[C@]2(OCc3cc4ccn(Cc5cc6ccccc6s5)c4cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H23NO6S/c26-11-19-21(27)22(28)23(29)24(31-19)17-9-18-13(7-15(17)12-30-24)5-6-25(18)10-16-8-14-3-1-2-4-20(14)32-16/h1-9,19,21-23,26-29H,10-12H2/t19-,21-,22+,23-,24+/m1/s1 |
| InChIKey | JVLNVUZQJXUIKK-ZXGKGEBGSA-N |
| XLogP | 2.06 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |