About 2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride
2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride (PubChem CID 24832191) has the molecular formula C19H33ClN2O2
and a molecular weight of 356.94 g/mol. Its IUPAC name is 2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride |
| PubChem CID | 24832191 |
| Molecular Formula | C19H33ClN2O2 |
| Molecular Weight | 356.94 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride |
| SMILES | CCN(CC)CC(=O)N(CC)C(C)COc1cc(C)cc(C)c1.Cl |
| InChI | InChI=1S/C19H32N2O2.ClH/c1-7-20(8-2)13-19(22)21(9-3)17(6)14-23-18-11-15(4)10-16(5)12-18;/h10-12,17H,7-9,13-14H2,1-6H3;1H |
| InChIKey | PUYKQFLVWAPCGH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.94 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride?
The IUPAC name of 2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride (CID 24832191) is 2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride.
What is the SMILES notation for 2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride?
The canonical SMILES for 2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride is CCN(CC)CC(=O)N(CC)C(C)COc1cc(C)cc(C)c1.Cl.
What is the InChIKey of 2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride?
The InChIKey is PUYKQFLVWAPCGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O2.ClH/c1-7-20(8-2)13-19(22)21(9-3)17(6)14-23-18-11-15(4)10-16(5)12-18;/h10-12,17H,7-9,13-14H2,1-6H3;1H.
What are the key properties of 2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride?
2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride has a molecular weight of 356.94 g/mol, XLogP of 3.68, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-N-[1-(3,5-dimethylphenoxy)propan-2-yl]-N-ethylacetamide;hydrochloride is sourced from PubChem (CID 24832191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).