About N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide
N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide (PubChem CID 24832250) has the molecular formula C8H11FN2OS
and a molecular weight of 202.25 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide.
Molecular Properties
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide |
| PubChem CID | 24832250 |
| Molecular Formula | C8H11FN2OS |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide |
| SMILES | Cc1nc(N(C)C(=O)CF)sc1C |
| InChI | InChI=1S/C8H11FN2OS/c1-5-6(2)13-8(10-5)11(3)7(12)4-9/h4H2,1-3H3 |
| InChIKey | AMCULKRSCGCHDO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide?
The IUPAC name of N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide (CID 24832250) is N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide.
What is the SMILES notation for N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide?
The canonical SMILES for N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide is Cc1nc(N(C)C(=O)CF)sc1C.
What is the InChIKey of N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide?
The InChIKey is AMCULKRSCGCHDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2OS/c1-5-6(2)13-8(10-5)11(3)7(12)4-9/h4H2,1-3H3.
What are the key properties of N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide?
N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide has a molecular weight of 202.25 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-fluoro-N-methylacetamide is sourced from PubChem (CID 24832250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).