N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid

C12H22N2O5 — CID 24832423

IUPACN'-(1-cyclohexylethyl)acetohydrazide;oxalic acid
SMILESCC(=O)NNC(C)C1CCCCC1.O=C(O)C(=O)O
InChIInChI=1S/C10H20N2O.C2H2O4/c1-8(11-12-9(2)13)10-6-4-3-5-7-10;3-1(4)2(5)6/h8,10-11H,3-7H2,1-2H3,(H,12,13);(H,3,4)(H,5,6)
InChIKeyJWKWRIHQZIIEIM-UHFFFAOYSA-N
MW274.32 g/mol
LogP0.75
Rot. Bonds3

About N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid

N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid (PubChem CID 24832423) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid.

Molecular Properties

Compound NameN'-(1-cyclohexylethyl)acetohydrazide;oxalic acid
PubChem CID24832423
Molecular FormulaC12H22N2O5
Molecular Weight274.32 g/mol
Exact Mass274.15
IUPAC NameN'-(1-cyclohexylethyl)acetohydrazide;oxalic acid
SMILESCC(=O)NNC(C)C1CCCCC1.O=C(O)C(=O)O
InChIInChI=1S/C10H20N2O.C2H2O4/c1-8(11-12-9(2)13)10-6-4-3-5-7-10;3-1(4)2(5)6/h8,10-11H,3-7H2,1-2H3,(H,12,13);(H,3,4)(H,5,6)
InChIKeyJWKWRIHQZIIEIM-UHFFFAOYSA-N
XLogP0.75
TPSA115.73 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.32
LogP ≤ 50.75
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid?
The IUPAC name of N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid (CID 24832423) is N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid.
What is the SMILES notation for N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid?
The canonical SMILES for N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid is CC(=O)NNC(C)C1CCCCC1.O=C(O)C(=O)O.
What is the InChIKey of N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid?
The InChIKey is JWKWRIHQZIIEIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O.C2H2O4/c1-8(11-12-9(2)13)10-6-4-3-5-7-10;3-1(4)2(5)6/h8,10-11H,3-7H2,1-2H3,(H,12,13);(H,3,4)(H,5,6).
What are the key properties of N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid?
N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid has a molecular weight of 274.32 g/mol, XLogP of 0.75, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid is sourced from PubChem (CID 24832423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).