C12H22N2O5 — CID 24832423
N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid (PubChem CID 24832423) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid.
| Compound Name | N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid |
|---|---|
| PubChem CID | 24832423 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N'-(1-cyclohexylethyl)acetohydrazide;oxalic acid |
| SMILES | CC(=O)NNC(C)C1CCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H20N2O.C2H2O4/c1-8(11-12-9(2)13)10-6-4-3-5-7-10;3-1(4)2(5)6/h8,10-11H,3-7H2,1-2H3,(H,12,13);(H,3,4)(H,5,6) |
| InChIKey | JWKWRIHQZIIEIM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|