About benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate
benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate (PubChem CID 24832520) has the molecular formula C19H16N2O3S
and a molecular weight of 352.42 g/mol. Its IUPAC name is benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate.
Molecular Properties
| Compound Name | benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate |
| PubChem CID | 24832520 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate |
| SMILES | Cc1cccc(-c2csc(NC(=O)C(=O)OCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C19H16N2O3S/c1-13-6-5-9-15(10-13)16-12-25-19(20-16)21-17(22)18(23)24-11-14-7-3-2-4-8-14/h2-10,12H,11H2,1H3,(H,20,21,22) |
| InChIKey | BGLKWQRFKHWMEF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate?
The IUPAC name of benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate (CID 24832520) is benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate.
What is the SMILES notation for benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate?
The canonical SMILES for benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate is Cc1cccc(-c2csc(NC(=O)C(=O)OCc3ccccc3)n2)c1.
What is the InChIKey of benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate?
The InChIKey is BGLKWQRFKHWMEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O3S/c1-13-6-5-9-15(10-13)16-12-25-19(20-16)21-17(22)18(23)24-11-14-7-3-2-4-8-14/h2-10,12H,11H2,1H3,(H,20,21,22).
What are the key properties of benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate?
benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate has a molecular weight of 352.42 g/mol, XLogP of 3.80, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[[4-(3-methylphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate is sourced from PubChem (CID 24832520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).