C22H25N3O2 — CID 24832548
(2E)-2-[9-(4-methylpiperazin-1-yl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene]acetonitrile oxide;hydrate (PubChem CID 24832548) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (2E)-2-[9-(4-methylpiperazin-1-yl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene]acetonitrile oxide;hydrate.
| Compound Name | (2E)-2-[9-(4-methylpiperazin-1-yl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene]acetonitrile oxide;hydrate |
|---|---|
| PubChem CID | 24832548 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (2E)-2-[9-(4-methylpiperazin-1-yl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene]acetonitrile oxide;hydrate |
| SMILES | CN1CCN(C2Cc3ccccc3/C(=C\C#[N+][O-])c3ccccc32)CC1.O |
| InChI | InChI=1S/C22H23N3O.H2O/c1-24-12-14-25(15-13-24)22-16-17-6-2-3-7-18(17)20(10-11-23-26)19-8-4-5-9-21(19)22;/h2-10,22H,12-16H2,1H3;1H2/b20-10+; |
| InChIKey | LWOBIOIIIZFEAF-XZISABOOSA-N |
| XLogP | 2.97 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|