C28H27NO9 — CID 24832715
2-hydroxypropane-1,2,3-tricarboxylic acid;(9-phenyl-10H-acridin-9-yl) propanoate (PubChem CID 24832715) has the molecular formula C28H27NO9 and a molecular weight of 521.52 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;(9-phenyl-10H-acridin-9-yl) propanoate.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;(9-phenyl-10H-acridin-9-yl) propanoate |
|---|---|
| PubChem CID | 24832715 |
| Molecular Formula | C28H27NO9 |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;(9-phenyl-10H-acridin-9-yl) propanoate |
| SMILES | CCC(=O)OC1(c2ccccc2)c2ccccc2Nc2ccccc21.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H19NO2.C6H8O7/c1-2-21(24)25-22(16-10-4-3-5-11-16)17-12-6-8-14-19(17)23-20-15-9-7-13-18(20)22;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-15,23H,2H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | ZJIMVRPRSDHMSX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 170.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |