About methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate
methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate (PubChem CID 24832867) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate.
Molecular Properties
| Compound Name | methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate |
| PubChem CID | 24832867 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate |
| SMILES | COC(=O)CCNC1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H17NO2/c1-16-13(15)6-7-14-12-8-10-4-2-3-5-11(10)9-12/h2-5,12,14H,6-9H2,1H3 |
| InChIKey | OMRREYMZINXGDB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate?
The IUPAC name of methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate (CID 24832867) is methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate.
What is the SMILES notation for methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate?
The canonical SMILES for methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate is COC(=O)CCNC1Cc2ccccc2C1.
What is the InChIKey of methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate?
The InChIKey is OMRREYMZINXGDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-16-13(15)6-7-14-12-8-10-4-2-3-5-11(10)9-12/h2-5,12,14H,6-9H2,1H3.
What are the key properties of methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate?
methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate has a molecular weight of 219.28 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,3-dihydro-1H-inden-2-ylamino)propanoate is sourced from PubChem (CID 24832867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).