About [2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide
[2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide (PubChem CID 24833116) has the molecular formula C27H32BrNO2
and a molecular weight of 482.46 g/mol. Its IUPAC name is [2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide.
Molecular Properties
| Compound Name | [2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide |
| PubChem CID | 24833116 |
| Molecular Formula | C27H32BrNO2 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | [2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide |
| SMILES | CC[N+](C)(CC)C(COC(=O)C(c1ccccc1)c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C27H32NO2.BrH/c1-4-28(3,5-2)25(22-15-9-6-10-16-22)21-30-27(29)26(23-17-11-7-12-18-23)24-19-13-8-14-20-24;/h6-20,25-26H,4-5,21H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | XCKJQDINEYRWRE-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide?
The IUPAC name of [2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide (CID 24833116) is [2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide.
What is the SMILES notation for [2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide?
The canonical SMILES for [2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide is CC[N+](C)(CC)C(COC(=O)C(c1ccccc1)c1ccccc1)c1ccccc1.[Br-].
What is the InChIKey of [2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide?
The InChIKey is XCKJQDINEYRWRE-UHFFFAOYSA-M. The full InChI is InChI=1S/C27H32NO2.BrH/c1-4-28(3,5-2)25(22-15-9-6-10-16-22)21-30-27(29)26(23-17-11-7-12-18-23)24-19-13-8-14-20-24;/h6-20,25-26H,4-5,21H2,1-3H3;1H/q+1;/p-1.
What are the key properties of [2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide?
[2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide has a molecular weight of 482.46 g/mol, XLogP of 2.59, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,2-diphenylacetyl)oxy-1-phenylethyl]-diethyl-methylazanium bromide is sourced from PubChem (CID 24833116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).