C24H45I2N3 — CID 24833666
2-[2-[diethyl(methyl)azaniumyl]ethyl-(1,2,3,4-tetrahydronaphthalen-2-yl)amino]ethyl-diethyl-methylazanium diiodide (PubChem CID 24833666) has the molecular formula C24H45I2N3 and a molecular weight of 629.45 g/mol. Its IUPAC name is 2-[2-[diethyl(methyl)azaniumyl]ethyl-(1,2,3,4-tetrahydronaphthalen-2-yl)amino]ethyl-diethyl-methylazanium diiodide.
| Compound Name | 2-[2-[diethyl(methyl)azaniumyl]ethyl-(1,2,3,4-tetrahydronaphthalen-2-yl)amino]ethyl-diethyl-methylazanium diiodide |
|---|---|
| PubChem CID | 24833666 |
| Molecular Formula | C24H45I2N3 |
| Molecular Weight | 629.45 g/mol |
| Exact Mass | 629.17 |
| IUPAC Name | 2-[2-[diethyl(methyl)azaniumyl]ethyl-(1,2,3,4-tetrahydronaphthalen-2-yl)amino]ethyl-diethyl-methylazanium diiodide |
| SMILES | CC[N+](C)(CC)CCN(CC[N+](C)(CC)CC)C1CCc2ccccc2C1.[I-].[I-] |
| InChI | InChI=1S/C24H45N3.2HI/c1-7-26(5,8-2)19-17-25(18-20-27(6,9-3)10-4)24-16-15-22-13-11-12-14-23(22)21-24;;/h11-14,24H,7-10,15-21H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | GJBSGTZEYXVKID-UHFFFAOYSA-L |
| XLogP | -2.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.45 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|