C30H33N3O6 — CID 24833826
2,5-dihydroxybenzoic acid;1,5-dimethyl-4-[(3-methyl-2-phenylmorpholin-4-yl)methyl]-2-phenylpyrazol-3-one (PubChem CID 24833826) has the molecular formula C30H33N3O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is 2,5-dihydroxybenzoic acid;1,5-dimethyl-4-[(3-methyl-2-phenylmorpholin-4-yl)methyl]-2-phenylpyrazol-3-one.
| Compound Name | 2,5-dihydroxybenzoic acid;1,5-dimethyl-4-[(3-methyl-2-phenylmorpholin-4-yl)methyl]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 24833826 |
| Molecular Formula | C30H33N3O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 2,5-dihydroxybenzoic acid;1,5-dimethyl-4-[(3-methyl-2-phenylmorpholin-4-yl)methyl]-2-phenylpyrazol-3-one |
| SMILES | Cc1c(CN2CCOC(c3ccccc3)C2C)c(=O)n(-c2ccccc2)n1C.O=C(O)c1cc(O)ccc1O |
| InChI | InChI=1S/C23H27N3O2.C7H6O4/c1-17-21(23(27)26(24(17)3)20-12-8-5-9-13-20)16-25-14-15-28-22(18(25)2)19-10-6-4-7-11-19;8-4-1-2-6(9)5(3-4)7(10)11/h4-13,18,22H,14-16H2,1-3H3;1-3,8-9H,(H,10,11) |
| InChIKey | OAZJUYSBMMOEFC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|