About 4-ethoxybenzaldehyde
4-ethoxybenzaldehyde (PubChem CID 24834) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 4-ethoxybenzaldehyde.
Molecular Properties
| Compound Name | 4-ethoxybenzaldehyde |
| PubChem CID | 24834 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 4-ethoxybenzaldehyde |
| SMILES | CCOc1ccc(C=O)cc1 |
| InChI | InChI=1S/C9H10O2/c1-2-11-9-5-3-8(7-10)4-6-9/h3-7H,2H2,1H3 |
| InChIKey | JRHHJNMASOIRDS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxybenzaldehyde?
The IUPAC name of 4-ethoxybenzaldehyde (CID 24834) is 4-ethoxybenzaldehyde.
What is the SMILES notation for 4-ethoxybenzaldehyde?
The canonical SMILES for 4-ethoxybenzaldehyde is CCOc1ccc(C=O)cc1.
What is the InChIKey of 4-ethoxybenzaldehyde?
The InChIKey is JRHHJNMASOIRDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-2-11-9-5-3-8(7-10)4-6-9/h3-7H,2H2,1H3.
What are the key properties of 4-ethoxybenzaldehyde?
4-ethoxybenzaldehyde has a molecular weight of 150.18 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxybenzaldehyde is sourced from PubChem (CID 24834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).