C24H34N4O5 — CID 24834068
1,3-bis[4-(dimethylamino)-2-oxobutyl]-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 24834068) has the molecular formula C24H34N4O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is 1,3-bis[4-(dimethylamino)-2-oxobutyl]-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-bis[4-(dimethylamino)-2-oxobutyl]-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 24834068 |
| Molecular Formula | C24H34N4O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 1,3-bis[4-(dimethylamino)-2-oxobutyl]-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(c2ccccc2)C(=O)N(CC(=O)CCN(C)C)C(=O)N(CC(=O)CCN(C)C)C1=O |
| InChI | InChI=1S/C24H34N4O5/c1-6-24(18-10-8-7-9-11-18)21(31)27(16-19(29)12-14-25(2)3)23(33)28(22(24)32)17-20(30)13-15-26(4)5/h7-11H,6,12-17H2,1-5H3 |
| InChIKey | QNPRNMKODUKREP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|