About disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate
disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate (PubChem CID 24834091) has the molecular formula C20H20N2Na2O3
and a molecular weight of 382.37 g/mol. Its IUPAC name is disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate.
Molecular Properties
| Compound Name | disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate |
| PubChem CID | 24834091 |
| Molecular Formula | C20H20N2Na2O3 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate |
| SMILES | CCCCC1(CCc2cccc3ccccc23)C(=O)N=C([O-])N=C1[O-].[Na+].[Na+] |
| InChI | InChI=1S/C20H22N2O3.2Na/c1-2-3-12-20(17(23)21-19(25)22-18(20)24)13-11-15-9-6-8-14-7-4-5-10-16(14)15;;/h4-10H,2-3,11-13H2,1H3,(H2,21,22,23,24,25);;/q;2*+1/p-2 |
| InChIKey | UDSSIJQWAMTIRE-UHFFFAOYSA-L |
| XLogP | -4.03 |
| TPSA | 87.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate?
The IUPAC name of disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate (CID 24834091) is disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate.
What is the SMILES notation for disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate?
The canonical SMILES for disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate is CCCCC1(CCc2cccc3ccccc23)C(=O)N=C([O-])N=C1[O-].[Na+].[Na+].
What is the InChIKey of disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate?
The InChIKey is UDSSIJQWAMTIRE-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H22N2O3.2Na/c1-2-3-12-20(17(23)21-19(25)22-18(20)24)13-11-15-9-6-8-14-7-4-5-10-16(14)15;;/h4-10H,2-3,11-13H2,1H3,(H2,21,22,23,24,25);;/q;2*+1/p-2.
What are the key properties of disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate?
disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate has a molecular weight of 382.37 g/mol, XLogP of -4.03, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;5-butyl-5-(2-naphthalen-1-ylethyl)-6-oxopyrimidine-2,4-diolate is sourced from PubChem (CID 24834091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).