C17H22N2O6 — CID 24834277
N-(1-azabicyclo[2.2.2]octan-3-yl)-2-methoxybenzamide;oxalic acid (PubChem CID 24834277) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-2-methoxybenzamide;oxalic acid.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-2-methoxybenzamide;oxalic acid |
|---|---|
| PubChem CID | 24834277 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-2-methoxybenzamide;oxalic acid |
| SMILES | COc1ccccc1C(=O)NC1CN2CCC1CC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H20N2O2.C2H2O4/c1-19-14-5-3-2-4-12(14)15(18)16-13-10-17-8-6-11(13)7-9-17;3-1(4)2(5)6/h2-5,11,13H,6-10H2,1H3,(H,16,18);(H,3,4)(H,5,6) |
| InChIKey | OHFCFQMITJPYLL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|