About N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine
N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine (PubChem CID 24834488) has the molecular formula C8H10FNO
and a molecular weight of 155.17 g/mol. Its IUPAC name is N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine.
Molecular Properties
| Compound Name | N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine |
| PubChem CID | 24834488 |
| Molecular Formula | C8H10FNO |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine |
| SMILES | Cc1cc(F)cc(C)c1NO |
| InChI | InChI=1S/C8H10FNO/c1-5-3-7(9)4-6(2)8(5)10-11/h3-4,10-11H,1-2H3 |
| InChIKey | JROFZZPJVPLMOA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine?
The IUPAC name of N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine (CID 24834488) is N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine.
What is the SMILES notation for N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine?
The canonical SMILES for N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine is Cc1cc(F)cc(C)c1NO.
What is the InChIKey of N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine?
The InChIKey is JROFZZPJVPLMOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNO/c1-5-3-7(9)4-6(2)8(5)10-11/h3-4,10-11H,1-2H3.
What are the key properties of N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine?
N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine has a molecular weight of 155.17 g/mol, XLogP of 2.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluoro-2,6-dimethylphenyl)hydroxylamine is sourced from PubChem (CID 24834488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).