C22H36N4 — CID 24834553
2,4-diethyl-6-methylbenzene-1,3-diamine;4,6-diethyl-2-methylbenzene-1,3-diamine (PubChem CID 24834553) has the molecular formula C22H36N4 and a molecular weight of 356.56 g/mol. Its IUPAC name is 2,4-diethyl-6-methylbenzene-1,3-diamine;4,6-diethyl-2-methylbenzene-1,3-diamine.
| Compound Name | 2,4-diethyl-6-methylbenzene-1,3-diamine;4,6-diethyl-2-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 24834553 |
| Molecular Formula | C22H36N4 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | 2,4-diethyl-6-methylbenzene-1,3-diamine;4,6-diethyl-2-methylbenzene-1,3-diamine |
| SMILES | CCc1cc(C)c(N)c(CC)c1N.CCc1cc(CC)c(N)c(C)c1N |
| InChI | InChI=1S/2C11H18N2/c1-4-8-6-9(5-2)11(13)7(3)10(8)12;1-4-8-6-7(3)10(12)9(5-2)11(8)13/h2*6H,4-5,12-13H2,1-3H3 |
| InChIKey | HGXVKAPCSIXGAK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|