C24H28N2O9 — CID 24834957
2-[6-(benzylideneamino)-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 24834957) has the molecular formula C24H28N2O9 and a molecular weight of 488.49 g/mol. Its IUPAC name is 2-[6-(benzylideneamino)-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-[6-(benzylideneamino)-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 24834957 |
| Molecular Formula | C24H28N2O9 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 2-[6-(benzylideneamino)-1,3-benzodioxol-5-yl]-N,N-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CN(C)CCc1cc2c(cc1/N=C/c1ccccc1)OCO2.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H20N2O2.C6H8O7/c1-20(2)9-8-15-10-17-18(22-13-21-17)11-16(15)19-12-14-6-4-3-5-7-14;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-7,10-12H,8-9,13H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b19-12+; |
| InChIKey | FSWVUFORBLYORG-NNTHFVATSA-N |
| XLogP | 2.02 |
| TPSA | 166.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|