C26H30N2O9 — CID 24834958
N,N-dimethyl-2-[6-[[(Z)-3-phenylprop-2-enylidene]amino]-1,3-benzodioxol-5-yl]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 24834958) has the molecular formula C26H30N2O9 and a molecular weight of 514.53 g/mol. Its IUPAC name is N,N-dimethyl-2-[6-[[(Z)-3-phenylprop-2-enylidene]amino]-1,3-benzodioxol-5-yl]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | N,N-dimethyl-2-[6-[[(Z)-3-phenylprop-2-enylidene]amino]-1,3-benzodioxol-5-yl]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 24834958 |
| Molecular Formula | C26H30N2O9 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | N,N-dimethyl-2-[6-[[(Z)-3-phenylprop-2-enylidene]amino]-1,3-benzodioxol-5-yl]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CN(C)CCc1cc2c(cc1/N=C/C=C\c1ccccc1)OCO2.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H22N2O2.C6H8O7/c1-22(2)12-10-17-13-19-20(24-15-23-19)14-18(17)21-11-6-9-16-7-4-3-5-8-16;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-9,11,13-14H,10,12,15H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b9-6-,21-11+; |
| InChIKey | BQSJNQKKMTZTJD-QOUBLFIDSA-N |
| XLogP | 2.69 |
| TPSA | 166.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|