About 6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride
6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride (PubChem CID 24835446) has the molecular formula C17H25ClN2O2S
and a molecular weight of 356.92 g/mol. Its IUPAC name is 6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride.
Molecular Properties
| Compound Name | 6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride |
| PubChem CID | 24835446 |
| Molecular Formula | C17H25ClN2O2S |
| Molecular Weight | 356.92 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride |
| SMILES | CC1COCC(C)N1CCCc1ccc2c(c1)sc(=O)n2C.Cl |
| InChI | InChI=1S/C17H24N2O2S.ClH/c1-12-10-21-11-13(2)19(12)8-4-5-14-6-7-15-16(9-14)22-17(20)18(15)3;/h6-7,9,12-13H,4-5,8,10-11H2,1-3H3;1H |
| InChIKey | WFFBKKDQFFBDQN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.92 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride?
The IUPAC name of 6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride (CID 24835446) is 6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride.
What is the SMILES notation for 6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride?
The canonical SMILES for 6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride is CC1COCC(C)N1CCCc1ccc2c(c1)sc(=O)n2C.Cl.
What is the InChIKey of 6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride?
The InChIKey is WFFBKKDQFFBDQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O2S.ClH/c1-12-10-21-11-13(2)19(12)8-4-5-14-6-7-15-16(9-14)22-17(20)18(15)3;/h6-7,9,12-13H,4-5,8,10-11H2,1-3H3;1H.
What are the key properties of 6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride?
6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride has a molecular weight of 356.92 g/mol, XLogP of 3.06, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(3,5-dimethylmorpholin-4-yl)propyl]-3-methyl-1,3-benzothiazol-2-one;hydrochloride is sourced from PubChem (CID 24835446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).