C17H32N2O2 — CID 24835735
(2R)-1-(diethylamino)-3-[(E)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol (PubChem CID 24835735) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is (2R)-1-(diethylamino)-3-[(E)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol.
| Compound Name | (2R)-1-(diethylamino)-3-[(E)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol |
|---|---|
| PubChem CID | 24835735 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | (2R)-1-(diethylamino)-3-[(E)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol |
| SMILES | CCN(CC)C[C@@H](O)CO/N=C1\C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C17H32N2O2/c1-6-19(7-2)11-14(20)12-21-18-15-10-13-8-9-17(15,5)16(13,3)4/h13-14,20H,6-12H2,1-5H3/b18-15+/t13-,14-,17+/m1/s1 |
| InChIKey | ILFLTLLQADLATM-XCKUNCRFSA-N |
| XLogP | 2.91 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|