C10H10Cl6 — CID 24835833
3,6,6-trichloro-1,7,7-tris(chloromethyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 24835833) has the molecular formula C10H10Cl6 and a molecular weight of 342.91 g/mol. Its IUPAC name is 3,6,6-trichloro-1,7,7-tris(chloromethyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 3,6,6-trichloro-1,7,7-tris(chloromethyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 24835833 |
| Molecular Formula | C10H10Cl6 |
| Molecular Weight | 342.91 g/mol |
| Exact Mass | 339.89 |
| IUPAC Name | 3,6,6-trichloro-1,7,7-tris(chloromethyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | ClCC1(CCl)C2CC(Cl)(Cl)C1(CCl)C=C2Cl |
| InChI | InChI=1S/C10H10Cl6/c11-3-8(4-12)6-1-10(15,16)9(8,5-13)2-7(6)14/h2,6H,1,3-5H2 |
| InChIKey | RMUJVSTWWPLUIR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.91 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|