About 2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide
2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide (PubChem CID 24836052) has the molecular formula C16H28N2O2
and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide |
| PubChem CID | 24836052 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide |
| SMILES | CCC(C(=O)NC1C(=O)C2(C)CCC1C2(C)C)N(C)C |
| InChI | InChI=1S/C16H28N2O2/c1-7-11(18(5)6)14(20)17-12-10-8-9-16(4,13(12)19)15(10,2)3/h10-12H,7-9H2,1-6H3,(H,17,20) |
| InChIKey | UKDOCYALNBTKDT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide?
The IUPAC name of 2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide (CID 24836052) is 2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide.
What is the SMILES notation for 2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide?
The canonical SMILES for 2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide is CCC(C(=O)NC1C(=O)C2(C)CCC1C2(C)C)N(C)C.
What is the InChIKey of 2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide?
The InChIKey is UKDOCYALNBTKDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O2/c1-7-11(18(5)6)14(20)17-12-10-8-9-16(4,13(12)19)15(10,2)3/h10-12H,7-9H2,1-6H3,(H,17,20).
What are the key properties of 2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide?
2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide has a molecular weight of 280.41 g/mol, XLogP of 1.84, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanyl)butanamide is sourced from PubChem (CID 24836052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).