About pyridin-2-ylmethyl N,N-diethylcarbamodithioate
pyridin-2-ylmethyl N,N-diethylcarbamodithioate (PubChem CID 24836180) has the molecular formula C11H16N2S2
and a molecular weight of 240.40 g/mol. Its IUPAC name is pyridin-2-ylmethyl N,N-diethylcarbamodithioate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl N,N-diethylcarbamodithioate |
| PubChem CID | 24836180 |
| Molecular Formula | C11H16N2S2 |
| Molecular Weight | 240.40 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | pyridin-2-ylmethyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCc1ccccn1 |
| InChI | InChI=1S/C11H16N2S2/c1-3-13(4-2)11(14)15-9-10-7-5-6-8-12-10/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | KVEMRZQIRJTORL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-ylmethyl N,N-diethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl N,N-diethylcarbamodithioate?
The IUPAC name of pyridin-2-ylmethyl N,N-diethylcarbamodithioate (CID 24836180) is pyridin-2-ylmethyl N,N-diethylcarbamodithioate.
What is the SMILES notation for pyridin-2-ylmethyl N,N-diethylcarbamodithioate?
The canonical SMILES for pyridin-2-ylmethyl N,N-diethylcarbamodithioate is CCN(CC)C(=S)SCc1ccccn1.
What is the InChIKey of pyridin-2-ylmethyl N,N-diethylcarbamodithioate?
The InChIKey is KVEMRZQIRJTORL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2S2/c1-3-13(4-2)11(14)15-9-10-7-5-6-8-12-10/h5-8H,3-4,9H2,1-2H3.
What are the key properties of pyridin-2-ylmethyl N,N-diethylcarbamodithioate?
pyridin-2-ylmethyl N,N-diethylcarbamodithioate has a molecular weight of 240.40 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl N,N-diethylcarbamodithioate is sourced from PubChem (CID 24836180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).