About O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride
O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride (PubChem CID 24836295) has the molecular formula C6H15ClN2OS
and a molecular weight of 198.72 g/mol. Its IUPAC name is O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride.
Molecular Properties
| Compound Name | O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride |
| PubChem CID | 24836295 |
| Molecular Formula | C6H15ClN2OS |
| Molecular Weight | 198.72 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride |
| SMILES | CNC(=S)OCCN(C)C.Cl |
| InChI | InChI=1S/C6H14N2OS.ClH/c1-7-6(10)9-5-4-8(2)3;/h4-5H2,1-3H3,(H,7,10);1H |
| InChIKey | DFGUBKNIKZPBIX-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.72 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride?
The IUPAC name of O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride (CID 24836295) is O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride.
What is the SMILES notation for O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride?
The canonical SMILES for O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride is CNC(=S)OCCN(C)C.Cl.
What is the InChIKey of O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride?
The InChIKey is DFGUBKNIKZPBIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2OS.ClH/c1-7-6(10)9-5-4-8(2)3;/h4-5H2,1-3H3,(H,7,10);1H.
What are the key properties of O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride?
O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride has a molecular weight of 198.72 g/mol, XLogP of 0.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[2-(dimethylamino)ethyl] N-methylcarbamothioate;hydrochloride is sourced from PubChem (CID 24836295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).