C22H27Cl2N3O2 — CID 24836839
1-naphthalen-2-yloxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-ol;dihydrochloride (PubChem CID 24836839) has the molecular formula C22H27Cl2N3O2 and a molecular weight of 436.38 g/mol. Its IUPAC name is 1-naphthalen-2-yloxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-ol;dihydrochloride.
| Compound Name | 1-naphthalen-2-yloxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 24836839 |
| Molecular Formula | C22H27Cl2N3O2 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 1-naphthalen-2-yloxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-2-ol;dihydrochloride |
| SMILES | Cl.Cl.OC(COc1ccc2ccccc2c1)CN1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H25N3O2.2ClH/c26-20(17-27-21-9-8-18-5-1-2-6-19(18)15-21)16-24-11-13-25(14-12-24)22-7-3-4-10-23-22;;/h1-10,15,20,26H,11-14,16-17H2;2*1H |
| InChIKey | QNVMQMDSZBQYTK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |