About 2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride
2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride (PubChem CID 24837030) has the molecular formula C13H27ClN2O2
and a molecular weight of 278.82 g/mol. Its IUPAC name is 2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride |
| PubChem CID | 24837030 |
| Molecular Formula | C13H27ClN2O2 |
| Molecular Weight | 278.82 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)NC1CCCCC1.Cl |
| InChI | InChI=1S/C13H26N2O2.ClH/c1-3-15(4-2)10-11-17-13(16)14-12-8-6-5-7-9-12;/h12H,3-11H2,1-2H3,(H,14,16);1H |
| InChIKey | WKFCHQWJBHPFBE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride?
The IUPAC name of 2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride (CID 24837030) is 2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride is CCN(CC)CCOC(=O)NC1CCCCC1.Cl.
What is the InChIKey of 2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride?
The InChIKey is WKFCHQWJBHPFBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2.ClH/c1-3-15(4-2)10-11-17-13(16)14-12-8-6-5-7-9-12;/h12H,3-11H2,1-2H3,(H,14,16);1H.
What are the key properties of 2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride?
2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride has a molecular weight of 278.82 g/mol, XLogP of 2.81, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl N-cyclohexylcarbamate;hydrochloride is sourced from PubChem (CID 24837030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).