C27H34N4O2S — CID 2483714
4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(piperidin-1-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 2483714) has the molecular formula C27H34N4O2S and a molecular weight of 478.66 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(piperidin-1-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | 4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(piperidin-1-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 2483714 |
| Molecular Formula | C27H34N4O2S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(piperidin-1-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | COc1cc2c(cc1OC)CN(c1nc(CN3CCCCC3)nc3sc4c(c13)CCCC4)CC2 |
| InChI | InChI=1S/C27H34N4O2S/c1-32-21-14-18-10-13-31(16-19(18)15-22(21)33-2)26-25-20-8-4-5-9-23(20)34-27(25)29-24(28-26)17-30-11-6-3-7-12-30/h14-15H,3-13,16-17H2,1-2H3 |
| InChIKey | CZHISYXHAMLNPP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |