C31H42FN3O — CID 24837181
(E,2E)-N-[2-(4-benzylpiperazin-1-yl)ethoxy]-2-[(4-fluorophenyl)methylidene]-6-pentylcyclohexan-1-imine (PubChem CID 24837181) has the molecular formula C31H42FN3O and a molecular weight of 491.70 g/mol. Its IUPAC name is (E,2E)-N-[2-(4-benzylpiperazin-1-yl)ethoxy]-2-[(4-fluorophenyl)methylidene]-6-pentylcyclohexan-1-imine.
| Compound Name | (E,2E)-N-[2-(4-benzylpiperazin-1-yl)ethoxy]-2-[(4-fluorophenyl)methylidene]-6-pentylcyclohexan-1-imine |
|---|---|
| PubChem CID | 24837181 |
| Molecular Formula | C31H42FN3O |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.33 |
| IUPAC Name | (E,2E)-N-[2-(4-benzylpiperazin-1-yl)ethoxy]-2-[(4-fluorophenyl)methylidene]-6-pentylcyclohexan-1-imine |
| SMILES | CCCCCC1CCCC(=C\c2ccc(F)cc2)/C1=N/OCCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C31H42FN3O/c1-2-3-5-11-28-12-8-13-29(24-26-14-16-30(32)17-15-26)31(28)33-36-23-22-34-18-20-35(21-19-34)25-27-9-6-4-7-10-27/h4,6-7,9-10,14-17,24,28H,2-3,5,8,11-13,18-23,25H2,1H3/b29-24+,33-31+ |
| InChIKey | NPVQAXGXSRQQFV-VBLHHQPVSA-N |
| XLogP | 6.78 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|