About trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride
trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride (PubChem CID 24837203) has the molecular formula C14H22ClNO
and a molecular weight of 255.79 g/mol. Its IUPAC name is trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride |
| PubChem CID | 24837203 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride |
| SMILES | CN[C@@H]1CCCC[C@H]1Oc1ccc(C)cc1.Cl |
| InChI | InChI=1S/C14H21NO.ClH/c1-11-7-9-12(10-8-11)16-14-6-4-3-5-13(14)15-2;/h7-10,13-15H,3-6H2,1-2H3;1H/t13-,14-;/m1./s1 |
| InChIKey | YBVGKMNMYQOMLX-DTPOWOMPSA-N |
| XLogP | 3.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride?
The IUPAC name of trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride (CID 24837203) is trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride.
What is the SMILES notation for trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride?
The canonical SMILES for trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride is CN[C@@H]1CCCC[C@H]1Oc1ccc(C)cc1.Cl.
What is the InChIKey of trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride?
The InChIKey is YBVGKMNMYQOMLX-DTPOWOMPSA-N. The full InChI is InChI=1S/C14H21NO.ClH/c1-11-7-9-12(10-8-11)16-14-6-4-3-5-13(14)15-2;/h7-10,13-15H,3-6H2,1-2H3;1H/t13-,14-;/m1./s1.
What are the key properties of trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride?
trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride has a molecular weight of 255.79 g/mol, XLogP of 3.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-N-methyl-2-(4-methylphenoxy)cyclohexan-1-amine;hydrochloride is sourced from PubChem (CID 24837203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).